C30H31NO8 — CID 142175002
methyl 4-(heptylcarbamoyl)-2-(3-methylperoxy-6-oxoxanthen-9-yl)benzenecarboperoxoate (PubChem CID 142175002) has the molecular formula C30H31NO8 and a molecular weight of 533.58 g/mol. Its IUPAC name is methyl 4-(heptylcarbamoyl)-2-(3-methylperoxy-6-oxoxanthen-9-yl)benzenecarboperoxoate.
| Compound Name | methyl 4-(heptylcarbamoyl)-2-(3-methylperoxy-6-oxoxanthen-9-yl)benzenecarboperoxoate |
|---|---|
| PubChem CID | 142175002 |
| Molecular Formula | C30H31NO8 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | methyl 4-(heptylcarbamoyl)-2-(3-methylperoxy-6-oxoxanthen-9-yl)benzenecarboperoxoate |
| SMILES | CCCCCCCNC(=O)c1ccc(C(=O)OOC)c(-c2c3ccc(=O)cc-3oc3cc(OOC)ccc23)c1 |
| InChI | InChI=1S/C30H31NO8/c1-4-5-6-7-8-15-31-29(33)19-9-12-22(30(34)39-36-3)25(16-19)28-23-13-10-20(32)17-26(23)37-27-18-21(38-35-2)11-14-24(27)28/h9-14,16-18H,4-8,15H2,1-3H3,(H,31,33) |
| InChIKey | DOFOHHRWIMKEQL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|