C25H17NO6 — CID 89165092
2-(3-methoxy-6-oxoxanthen-9-yl)-5-(prop-2-ynylcarbamoyl)benzoic acid (PubChem CID 89165092) has the molecular formula C25H17NO6 and a molecular weight of 427.41 g/mol. Its IUPAC name is 2-(3-methoxy-6-oxoxanthen-9-yl)-5-(prop-2-ynylcarbamoyl)benzoic acid.
| Compound Name | 2-(3-methoxy-6-oxoxanthen-9-yl)-5-(prop-2-ynylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 89165092 |
| Molecular Formula | C25H17NO6 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-(3-methoxy-6-oxoxanthen-9-yl)-5-(prop-2-ynylcarbamoyl)benzoic acid |
| SMILES | C#CCNC(=O)c1ccc(-c2c3ccc(=O)cc-3oc3cc(OC)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C25H17NO6/c1-3-10-26-24(28)14-4-7-17(20(11-14)25(29)30)23-18-8-5-15(27)12-21(18)32-22-13-16(31-2)6-9-19(22)23/h1,4-9,11-13H,10H2,2H3,(H,26,28)(H,29,30) |
| InChIKey | SVIBFGMFGFKLBM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|