C42H28O5 — CID 101145984
methyl 3-(3-methoxy-6-oxoxanthen-9-yl)-9,10-diphenylanthracene-2-carboxylate (PubChem CID 101145984) has the molecular formula C42H28O5 and a molecular weight of 612.68 g/mol. Its IUPAC name is methyl 3-(3-methoxy-6-oxoxanthen-9-yl)-9,10-diphenylanthracene-2-carboxylate.
| Compound Name | methyl 3-(3-methoxy-6-oxoxanthen-9-yl)-9,10-diphenylanthracene-2-carboxylate |
|---|---|
| PubChem CID | 101145984 |
| Molecular Formula | C42H28O5 |
| Molecular Weight | 612.68 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | methyl 3-(3-methoxy-6-oxoxanthen-9-yl)-9,10-diphenylanthracene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(-c3ccccc3)c3ccccc3c(-c3ccccc3)c2cc1-c1c2ccc(=O)cc-2oc2cc(OC)ccc12 |
| InChI | InChI=1S/C42H28O5/c1-45-28-18-20-32-38(22-28)47-37-21-27(43)17-19-31(37)41(32)35-23-33-34(24-36(35)42(44)46-2)40(26-13-7-4-8-14-26)30-16-10-9-15-29(30)39(33)25-11-5-3-6-12-25/h3-24H,1-2H3 |
| InChIKey | CKBCOWJZKLWYEE-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.68 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|