C22H14N2O7 — CID 89490490
4-O-amino 1-O-methyl 2-(3-nitroso-6-oxoxanthen-9-yl)benzene-1,4-dicarboxylate (PubChem CID 89490490) has the molecular formula C22H14N2O7 and a molecular weight of 418.36 g/mol. Its IUPAC name is 4-O-amino 1-O-methyl 2-(3-nitroso-6-oxoxanthen-9-yl)benzene-1,4-dicarboxylate.
| Compound Name | 4-O-amino 1-O-methyl 2-(3-nitroso-6-oxoxanthen-9-yl)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 89490490 |
| Molecular Formula | C22H14N2O7 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 4-O-amino 1-O-methyl 2-(3-nitroso-6-oxoxanthen-9-yl)benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)ON)cc1-c1c2ccc(=O)cc-2oc2cc(N=O)ccc12 |
| InChI | InChI=1S/C22H14N2O7/c1-29-22(27)14-5-2-11(21(26)31-23)8-17(14)20-15-6-3-12(24-28)9-18(15)30-19-10-13(25)4-7-16(19)20/h2-10H,23H2,1H3 |
| InChIKey | QAPVPXZNFLSLSR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|