C22H17NO5 — CID 2907692
ethyl 5-amino-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoate (PubChem CID 2907692) has the molecular formula C22H17NO5 and a molecular weight of 375.38 g/mol. Its IUPAC name is ethyl 5-amino-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoate.
| Compound Name | ethyl 5-amino-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoate |
|---|---|
| PubChem CID | 2907692 |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | ethyl 5-amino-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoate |
| SMILES | CCOC(=O)c1cc(N)ccc1-c1c2ccc(=O)cc-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C22H17NO5/c1-2-27-22(26)18-9-12(23)3-6-15(18)21-16-7-4-13(24)10-19(16)28-20-11-14(25)5-8-17(20)21/h3-11,24H,2,23H2,1H3 |
| InChIKey | MUGROJVUWOVYPG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|