C26H18O10 — CID 59392436
[2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-(3-hydroxy-6-oxoxanthen-9-yl)benzoate (PubChem CID 59392436) has the molecular formula C26H18O10 and a molecular weight of 490.42 g/mol. Its IUPAC name is [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-(3-hydroxy-6-oxoxanthen-9-yl)benzoate.
| Compound Name | [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-(3-hydroxy-6-oxoxanthen-9-yl)benzoate |
|---|---|
| PubChem CID | 59392436 |
| Molecular Formula | C26H18O10 |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | [2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] 2-(3-hydroxy-6-oxoxanthen-9-yl)benzoate |
| SMILES | O=C1OC(C(O)COC(=O)c2ccccc2-c2c3ccc(=O)cc-3oc3cc(O)ccc23)C(O)=C1O |
| InChI | InChI=1S/C26H18O10/c27-12-5-7-16-19(9-12)35-20-10-13(28)6-8-17(20)21(16)14-3-1-2-4-15(14)25(32)34-11-18(29)24-22(30)23(31)26(33)36-24/h1-10,18,24,27,29-31H,11H2 |
| InChIKey | JZSDJUJZWIIRGB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 163.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|