C24H23NO12P2 — CID 10312140
2-[2-[[2-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]amino]ethoxy]ethyl phosphono hydrogen phosphate (PubChem CID 10312140) has the molecular formula C24H23NO12P2 and a molecular weight of 579.39 g/mol. Its IUPAC name is 2-[2-[[2-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]amino]ethoxy]ethyl phosphono hydrogen phosphate.
| Compound Name | 2-[2-[[2-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]amino]ethoxy]ethyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10312140 |
| Molecular Formula | C24H23NO12P2 |
| Molecular Weight | 579.39 g/mol |
| Exact Mass | 579.07 |
| IUPAC Name | 2-[2-[[2-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]amino]ethoxy]ethyl phosphono hydrogen phosphate |
| SMILES | O=C(NCCOCCOP(=O)(O)OP(=O)(O)O)c1ccccc1-c1c2ccc(=O)cc-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C24H23NO12P2/c26-15-5-7-19-21(13-15)36-22-14-16(27)6-8-20(22)23(19)17-3-1-2-4-18(17)24(28)25-9-10-34-11-12-35-39(32,33)37-38(29,30)31/h1-8,13-14,26H,9-12H2,(H,25,28)(H,32,33)(H2,29,30,31) |
| InChIKey | VTRUFOUDDQYSLP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 202.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|