C30H26BN2O6 — CID 88564157
CID 88564157 (PubChem CID 88564157) has the molecular formula C30H26BN2O6 and a molecular weight of 521.36 g/mol.
| Compound Name | CID 88564157 |
|---|---|
| PubChem CID | 88564157 |
| Molecular Formula | C30H26BN2O6 |
| Molecular Weight | 521.36 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | — |
| SMILES | CN(CCNC(=O)c1ccccc1-c1c2ccc(=O)cc-2oc2cc(O)ccc12)Cc1ccccc1O[B]O |
| InChI | InChI=1S/C30H26BN2O6/c1-33(18-19-6-2-5-9-26(19)39-31-37)15-14-32-30(36)23-8-4-3-7-22(23)29-24-12-10-20(34)16-27(24)38-28-17-21(35)11-13-25(28)29/h2-13,16-17,34,37H,14-15,18H2,1H3,(H,32,36) |
| InChIKey | YPGMASHJJLOXKF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|