C28H19NO7 — CID 71667902
3-[3-(4-hydroxy-N-methylanilino)-6-oxoxanthen-9-yl]phthalic acid (PubChem CID 71667902) has the molecular formula C28H19NO7 and a molecular weight of 481.46 g/mol. Its IUPAC name is 3-[3-(4-hydroxy-N-methylanilino)-6-oxoxanthen-9-yl]phthalic acid.
| Compound Name | 3-[3-(4-hydroxy-N-methylanilino)-6-oxoxanthen-9-yl]phthalic acid |
|---|---|
| PubChem CID | 71667902 |
| Molecular Formula | C28H19NO7 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 3-[3-(4-hydroxy-N-methylanilino)-6-oxoxanthen-9-yl]phthalic acid |
| SMILES | CN(c1ccc(O)cc1)c1ccc2c(-c3cccc(C(=O)O)c3C(=O)O)c3ccc(=O)cc-3oc2c1 |
| InChI | InChI=1S/C28H19NO7/c1-29(15-5-8-17(30)9-6-15)16-7-11-19-23(13-16)36-24-14-18(31)10-12-20(24)25(19)21-3-2-4-22(27(32)33)26(21)28(34)35/h2-14,30H,1H3,(H,32,33)(H,34,35) |
| InChIKey | DARVVWDAECYPMT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|