C55H53N3O4P+ — CID 163471005
4-[4-[2-[4-[3-(4-hydroxy-N-methylanilino)-6-oxoxanthen-9-yl]-3-methylphenyl]-2-oxoethyl]piperazin-1-yl]butyl-triphenylphosphanium (PubChem CID 163471005) has the molecular formula C55H53N3O4P+ and a molecular weight of 851.02 g/mol. Its IUPAC name is 4-[4-[2-[4-[3-(4-hydroxy-N-methylanilino)-6-oxoxanthen-9-yl]-3-methylphenyl]-2-oxoethyl]piperazin-1-yl]butyl-triphenylphosphanium.
| Compound Name | 4-[4-[2-[4-[3-(4-hydroxy-N-methylanilino)-6-oxoxanthen-9-yl]-3-methylphenyl]-2-oxoethyl]piperazin-1-yl]butyl-triphenylphosphanium |
|---|---|
| PubChem CID | 163471005 |
| Molecular Formula | C55H53N3O4P+ |
| Molecular Weight | 851.02 g/mol |
| Exact Mass | 850.38 |
| IUPAC Name | 4-[4-[2-[4-[3-(4-hydroxy-N-methylanilino)-6-oxoxanthen-9-yl]-3-methylphenyl]-2-oxoethyl]piperazin-1-yl]butyl-triphenylphosphanium |
| SMILES | Cc1cc(C(=O)CN2CCN(CCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)CC2)ccc1-c1c2ccc(=O)cc-2oc2cc(N(C)c3ccc(O)cc3)ccc12 |
| InChI | InChI=1S/C55H52N3O4P/c1-40-36-41(20-27-49(40)55-50-28-23-43(56(2)42-21-24-44(59)25-22-42)37-53(50)62-54-38-45(60)26-29-51(54)55)52(61)39-58-33-31-57(32-34-58)30-12-13-35-63(46-14-6-3-7-15-46,47-16-8-4-9-17-47)48-18-10-5-11-19-48/h3-11,14-29,36-38H,12-13,30-35,39H2,1-2H3/p+1 |
| InChIKey | YQJYRKTZYLVEMV-UHFFFAOYSA-O |
| XLogP | 9.92 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.02 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|