C39H35N5O6S — CID 46183977
9-[4-[4-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylpiperazine-1-carbonyl]-2-methylphenyl]-6-hydroxyxanthen-3-one (PubChem CID 46183977) has the molecular formula C39H35N5O6S and a molecular weight of 701.81 g/mol. Its IUPAC name is 9-[4-[4-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylpiperazine-1-carbonyl]-2-methylphenyl]-6-hydroxyxanthen-3-one.
| Compound Name | 9-[4-[4-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylpiperazine-1-carbonyl]-2-methylphenyl]-6-hydroxyxanthen-3-one |
|---|---|
| PubChem CID | 46183977 |
| Molecular Formula | C39H35N5O6S |
| Molecular Weight | 701.81 g/mol |
| Exact Mass | 701.23 |
| IUPAC Name | 9-[4-[4-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylpiperazine-1-carbonyl]-2-methylphenyl]-6-hydroxyxanthen-3-one |
| SMILES | Cc1cc(C(=O)N2CCN(S(=O)(=O)c3ccc(/N=N/c4ccc(N(C)C)cc4)cc3)CC2)ccc1-c1c2ccc(=O)cc-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C39H35N5O6S/c1-25-22-26(4-15-33(25)38-34-16-11-30(45)23-36(34)50-37-24-31(46)12-17-35(37)38)39(47)43-18-20-44(21-19-43)51(48,49)32-13-7-28(8-14-32)41-40-27-5-9-29(10-6-27)42(2)3/h4-17,22-24,45H,18-21H2,1-3H3/b41-40+ |
| InChIKey | RKNVLFSPXAMTPH-CDJCAARLSA-N |
| XLogP | 7.21 |
| TPSA | 136.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.81 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|