C29H32IN4O4S+ — CID 11505665
[6-(dimethylamino)-9-[2-[4-(2-iodoacetyl)piperazin-1-yl]sulfonylphenyl]xanthen-3-ylidene]-dimethylazanium (PubChem CID 11505665) has the molecular formula C29H32IN4O4S+ and a molecular weight of 659.57 g/mol. Its IUPAC name is [6-(dimethylamino)-9-[2-[4-(2-iodoacetyl)piperazin-1-yl]sulfonylphenyl]xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [6-(dimethylamino)-9-[2-[4-(2-iodoacetyl)piperazin-1-yl]sulfonylphenyl]xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 11505665 |
| Molecular Formula | C29H32IN4O4S+ |
| Molecular Weight | 659.57 g/mol |
| Exact Mass | 659.12 |
| IUPAC Name | [6-(dimethylamino)-9-[2-[4-(2-iodoacetyl)piperazin-1-yl]sulfonylphenyl]xanthen-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(-c3ccccc3S(=O)(=O)N3CCN(C(=O)CI)CC3)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C29H32IN4O4S/c1-31(2)20-9-11-22-25(17-20)38-26-18-21(32(3)4)10-12-23(26)29(22)24-7-5-6-8-27(24)39(36,37)34-15-13-33(14-16-34)28(35)19-30/h5-12,17-18H,13-16,19H2,1-4H3/q+1 |
| InChIKey | BLHIAYAXHWELKR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 77.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|