C25H27N2O+ — CID 22946669
[6-(dimethylamino)-9-(4-ethylphenyl)xanthen-3-ylidene]-dimethylazanium (PubChem CID 22946669) has the molecular formula C25H27N2O+ and a molecular weight of 371.50 g/mol. Its IUPAC name is [6-(dimethylamino)-9-(4-ethylphenyl)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [6-(dimethylamino)-9-(4-ethylphenyl)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 22946669 |
| Molecular Formula | C25H27N2O+ |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | [6-(dimethylamino)-9-(4-ethylphenyl)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CCc1ccc(-c2c3ccc(=[N+](C)C)cc-3oc3cc(N(C)C)ccc23)cc1 |
| InChI | InChI=1S/C25H27N2O/c1-6-17-7-9-18(10-8-17)25-21-13-11-19(26(2)3)15-23(21)28-24-16-20(27(4)5)12-14-22(24)25/h7-16H,6H2,1-5H3/q+1 |
| InChIKey | KTEVGHZJAIBWKK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 19.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|