C32H34N3O6+ — CID 123764098
[9-[4-[5-(2,5-dihydroxypyrrol-1-yl)oxy-5-oxopentoxy]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 123764098) has the molecular formula C32H34N3O6+ and a molecular weight of 556.64 g/mol. Its IUPAC name is [9-[4-[5-(2,5-dihydroxypyrrol-1-yl)oxy-5-oxopentoxy]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[4-[5-(2,5-dihydroxypyrrol-1-yl)oxy-5-oxopentoxy]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 123764098 |
| Molecular Formula | C32H34N3O6+ |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | [9-[4-[5-(2,5-dihydroxypyrrol-1-yl)oxy-5-oxopentoxy]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(-c3ccc(OCCCCC(=O)On4c(O)ccc4O)cc3)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C32H33N3O6/c1-33(2)22-10-14-25-27(19-22)40-28-20-23(34(3)4)11-15-26(28)32(25)21-8-12-24(13-9-21)39-18-6-5-7-31(38)41-35-29(36)16-17-30(35)37/h8-17,19-20H,5-7,18H2,1-4H3,(H-,36,37)/p+1 |
| InChIKey | AJKWFATYIFGAAI-UHFFFAOYSA-O |
| XLogP | 4.72 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|