C24H23ClN2O — CID 59705969
9-[4-(chloromethyl)phenyl]-6-ethylimino-N,N-dimethylxanthen-3-amine (PubChem CID 59705969) has the molecular formula C24H23ClN2O and a molecular weight of 390.91 g/mol. Its IUPAC name is 9-[4-(chloromethyl)phenyl]-6-ethylimino-N,N-dimethylxanthen-3-amine.
| Compound Name | 9-[4-(chloromethyl)phenyl]-6-ethylimino-N,N-dimethylxanthen-3-amine |
|---|---|
| PubChem CID | 59705969 |
| Molecular Formula | C24H23ClN2O |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 9-[4-(chloromethyl)phenyl]-6-ethylimino-N,N-dimethylxanthen-3-amine |
| SMILES | CC/N=c1\ccc2c(-c3ccc(CCl)cc3)c3ccc(N(C)C)cc3oc-2c1 |
| InChI | InChI=1S/C24H23ClN2O/c1-4-26-18-9-11-20-22(13-18)28-23-14-19(27(2)3)10-12-21(23)24(20)17-7-5-16(15-25)6-8-17/h5-14H,4,15H2,1-3H3/b26-18+ |
| InChIKey | YRAJDCILKZHQMI-NLRVBDNBSA-N |
| XLogP | 5.93 |
| TPSA | 28.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|