C33H35N3O10 — CID 175407865
acetyloxymethyl 2-[N-[2-(acetyloxymethoxy)-2-oxoethyl]-5-[3-(dimethylamino)-6-methyliminoxanthen-9-yl]-2-methoxyanilino]acetate (PubChem CID 175407865) has the molecular formula C33H35N3O10 and a molecular weight of 633.65 g/mol. Its IUPAC name is acetyloxymethyl 2-[N-[2-(acetyloxymethoxy)-2-oxoethyl]-5-[3-(dimethylamino)-6-methyliminoxanthen-9-yl]-2-methoxyanilino]acetate.
| Compound Name | acetyloxymethyl 2-[N-[2-(acetyloxymethoxy)-2-oxoethyl]-5-[3-(dimethylamino)-6-methyliminoxanthen-9-yl]-2-methoxyanilino]acetate |
|---|---|
| PubChem CID | 175407865 |
| Molecular Formula | C33H35N3O10 |
| Molecular Weight | 633.65 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | acetyloxymethyl 2-[N-[2-(acetyloxymethoxy)-2-oxoethyl]-5-[3-(dimethylamino)-6-methyliminoxanthen-9-yl]-2-methoxyanilino]acetate |
| SMILES | C/N=c1\ccc2c(-c3ccc(OC)c(N(CC(=O)OCOC(C)=O)CC(=O)OCOC(C)=O)c3)c3ccc(N(C)C)cc3oc-2c1 |
| InChI | InChI=1S/C33H35N3O10/c1-20(37)42-18-44-31(39)16-36(17-32(40)45-19-43-21(2)38)27-13-22(7-12-28(27)41-6)33-25-10-8-23(34-3)14-29(25)46-30-15-24(35(4)5)9-11-26(30)33/h7-15H,16-19H2,1-6H3/b34-23+ |
| InChIKey | SEEWILFRKYRMCI-PPFNPFNJSA-N |
| XLogP | 3.74 |
| TPSA | 146.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.65 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|