C41H54N6O9 — CID 123752527
2-[bis(carboxymethyl)amino]-6-[4-[2-(dimethylamino)-4-[3-(dimethylamino)-6-methyliminoxanthen-9-yl]-N-ethyl-5-methoxyanilino]butanoylamino]hexanoic acid (PubChem CID 123752527) has the molecular formula C41H54N6O9 and a molecular weight of 774.92 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-6-[4-[2-(dimethylamino)-4-[3-(dimethylamino)-6-methyliminoxanthen-9-yl]-N-ethyl-5-methoxyanilino]butanoylamino]hexanoic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-6-[4-[2-(dimethylamino)-4-[3-(dimethylamino)-6-methyliminoxanthen-9-yl]-N-ethyl-5-methoxyanilino]butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 123752527 |
| Molecular Formula | C41H54N6O9 |
| Molecular Weight | 774.92 g/mol |
| Exact Mass | 774.40 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-6-[4-[2-(dimethylamino)-4-[3-(dimethylamino)-6-methyliminoxanthen-9-yl]-N-ethyl-5-methoxyanilino]butanoylamino]hexanoic acid |
| SMILES | CCN(CCCC(=O)NCCCCC(C(=O)O)N(CC(=O)O)CC(=O)O)c1cc(OC)c(-c2c3cc/c(=N\C)cc-3oc3cc(N(C)C)ccc23)cc1N(C)C |
| InChI | InChI=1S/C41H54N6O9/c1-8-46(19-11-13-37(48)43-18-10-9-12-31(41(53)54)47(24-38(49)50)25-39(51)52)33-23-34(55-7)30(22-32(33)45(5)6)40-28-16-14-26(42-2)20-35(28)56-36-21-27(44(3)4)15-17-29(36)40/h14-17,20-23,31H,8-13,18-19,24-25H2,1-7H3,(H,43,48)(H,49,50)(H,51,52)(H,53,54)/b42-26+ |
| InChIKey | RANYFOQGAIOMAR-OOWNWPBNSA-N |
| XLogP | 4.69 |
| TPSA | 188.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|