C40H52N6O9 — CID 72549238
6-[4-[4-(3-amino-6-iminoxanthen-9-yl)-2-(diethylamino)-N-ethyl-5-methoxyanilino]butanoylamino]-2-[bis(carboxymethyl)amino]hexanoic acid (PubChem CID 72549238) has the molecular formula C40H52N6O9 and a molecular weight of 760.89 g/mol. Its IUPAC name is 6-[4-[4-(3-amino-6-iminoxanthen-9-yl)-2-(diethylamino)-N-ethyl-5-methoxyanilino]butanoylamino]-2-[bis(carboxymethyl)amino]hexanoic acid.
| Compound Name | 6-[4-[4-(3-amino-6-iminoxanthen-9-yl)-2-(diethylamino)-N-ethyl-5-methoxyanilino]butanoylamino]-2-[bis(carboxymethyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 72549238 |
| Molecular Formula | C40H52N6O9 |
| Molecular Weight | 760.89 g/mol |
| Exact Mass | 760.38 |
| IUPAC Name | 6-[4-[4-(3-amino-6-iminoxanthen-9-yl)-2-(diethylamino)-N-ethyl-5-methoxyanilino]butanoylamino]-2-[bis(carboxymethyl)amino]hexanoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3cc(N(CC)CC)c(N(CC)CCCC(=O)NCCCCC(C(=O)O)N(CC(=O)O)CC(=O)O)cc3OC)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C40H52N6O9/c1-5-44(6-2)31-21-29(39-27-15-13-25(41)19-34(27)55-35-20-26(42)14-16-28(35)39)33(54-4)22-32(31)45(7-3)18-10-12-36(47)43-17-9-8-11-30(40(52)53)46(23-37(48)49)24-38(50)51/h13-16,19-22,30,41H,5-12,17-18,23-24,42H2,1-4H3,(H,43,47)(H,48,49)(H,50,51)(H,52,53)/b41-25+ |
| InChIKey | NTSFBODPPIOYGC-UACWCTJZSA-N |
| XLogP | 4.94 |
| TPSA | 222.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.89 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|