C28H30N2O3 — CID 11576575
octyl 2-(3-amino-6-iminoxanthen-9-yl)benzoate (PubChem CID 11576575) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is octyl 2-(3-amino-6-iminoxanthen-9-yl)benzoate.
| Compound Name | octyl 2-(3-amino-6-iminoxanthen-9-yl)benzoate |
|---|---|
| PubChem CID | 11576575 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | octyl 2-(3-amino-6-iminoxanthen-9-yl)benzoate |
| SMILES | [H]/N=c1\ccc2c(-c3ccccc3C(=O)OCCCCCCCC)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C28H30N2O3/c1-2-3-4-5-6-9-16-32-28(31)22-11-8-7-10-21(22)27-23-14-12-19(29)17-25(23)33-26-18-20(30)13-15-24(26)27/h7-8,10-15,17-18,29H,2-6,9,16,30H2,1H3/b29-19+ |
| InChIKey | BGKUCJZNOISCLC-VUTHCHCSSA-N |
| XLogP | 6.78 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|