C31H33ClF3N3O4 — CID 162559530
3-(3-amino-6-iminoxanthen-9-yl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 162559530) has the molecular formula C31H33ClF3N3O4 and a molecular weight of 604.07 g/mol. Its IUPAC name is 3-(3-amino-6-iminoxanthen-9-yl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | 3-(3-amino-6-iminoxanthen-9-yl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 162559530 |
| Molecular Formula | C31H33ClF3N3O4 |
| Molecular Weight | 604.07 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | 3-(3-amino-6-iminoxanthen-9-yl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | [H]/N=c1\ccc2c(-c3cc(C(=O)NCCOCCOCCCCCCCl)ccc3C(F)(F)F)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C31H33ClF3N3O4/c32-11-3-1-2-4-13-40-15-16-41-14-12-38-30(39)20-5-10-26(31(33,34)35)25(17-20)29-23-8-6-21(36)18-27(23)42-28-19-22(37)7-9-24(28)29/h5-10,17-19,36H,1-4,11-16,37H2,(H,38,39)/b36-21+ |
| InChIKey | SDZVIAPAQMBFKF-QLQYKETESA-N |
| XLogP | 6.85 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.07 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|