C33H40ClN3O5 — CID 86305256
[2-(3-amino-6-dimethylazaniumylidenexanthen-9-yl)-5-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyl]phenyl]methanolate (PubChem CID 86305256) has the molecular formula C33H40ClN3O5 and a molecular weight of 594.15 g/mol. Its IUPAC name is [2-(3-amino-6-dimethylazaniumylidenexanthen-9-yl)-5-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyl]phenyl]methanolate.
| Compound Name | [2-(3-amino-6-dimethylazaniumylidenexanthen-9-yl)-5-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyl]phenyl]methanolate |
|---|---|
| PubChem CID | 86305256 |
| Molecular Formula | C33H40ClN3O5 |
| Molecular Weight | 594.15 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | [2-(3-amino-6-dimethylazaniumylidenexanthen-9-yl)-5-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyl]phenyl]methanolate |
| SMILES | C[N+](C)=c1ccc2c(-c3ccc(C(=O)NCCOCCOCCCCCCCl)cc3C[O-])c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C33H39ClN3O5/c1-37(2)26-9-12-29-31(21-26)42-30-20-25(35)8-11-28(30)32(29)27-10-7-23(19-24(27)22-38)33(39)36-14-16-41-18-17-40-15-6-4-3-5-13-34/h7-12,19-21,35H,3-6,13-18,22H2,1-2H3,(H,36,39)/q-1/p+1 |
| InChIKey | IDBRZPDZBIEJFM-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.15 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|