C22H31ClN2O5 — CID 102440671
2-(7-amino-4-methyl-2-oxochromen-3-yl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide (PubChem CID 102440671) has the molecular formula C22H31ClN2O5 and a molecular weight of 438.95 g/mol. Its IUPAC name is 2-(7-amino-4-methyl-2-oxochromen-3-yl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide.
| Compound Name | 2-(7-amino-4-methyl-2-oxochromen-3-yl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 102440671 |
| Molecular Formula | C22H31ClN2O5 |
| Molecular Weight | 438.95 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-(7-amino-4-methyl-2-oxochromen-3-yl)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]acetamide |
| SMILES | Cc1c(CC(=O)NCCOCCOCCCCCCCl)c(=O)oc2cc(N)ccc12 |
| InChI | InChI=1S/C22H31ClN2O5/c1-16-18-7-6-17(24)14-20(18)30-22(27)19(16)15-21(26)25-9-11-29-13-12-28-10-5-3-2-4-8-23/h6-7,14H,2-5,8-13,15,24H2,1H3,(H,25,26) |
| InChIKey | IWZGQOPYOAZLIW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.95 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|