C24H23N5O4 — CID 25007275
2-(7-amino-4-methyl-2-oxochromen-3-yl)-N-[[4-[(4-aminopyrimidin-2-yl)oxymethyl]phenyl]methyl]acetamide (PubChem CID 25007275) has the molecular formula C24H23N5O4 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-(7-amino-4-methyl-2-oxochromen-3-yl)-N-[[4-[(4-aminopyrimidin-2-yl)oxymethyl]phenyl]methyl]acetamide.
| Compound Name | 2-(7-amino-4-methyl-2-oxochromen-3-yl)-N-[[4-[(4-aminopyrimidin-2-yl)oxymethyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 25007275 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 2-(7-amino-4-methyl-2-oxochromen-3-yl)-N-[[4-[(4-aminopyrimidin-2-yl)oxymethyl]phenyl]methyl]acetamide |
| SMILES | Cc1c(CC(=O)NCc2ccc(COc3nccc(N)n3)cc2)c(=O)oc2cc(N)ccc12 |
| InChI | InChI=1S/C24H23N5O4/c1-14-18-7-6-17(25)10-20(18)33-23(31)19(14)11-22(30)28-12-15-2-4-16(5-3-15)13-32-24-27-9-8-21(26)29-24/h2-10H,11-13,25H2,1H3,(H,28,30)(H2,26,27,29) |
| InChIKey | WMPPXSZGINGDED-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 146.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|