C26H27NO4 — CID 23606134
2-(3-tert-butyl-5-methyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[(4-methylphenyl)methyl]acetamide (PubChem CID 23606134) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-(3-tert-butyl-5-methyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[(4-methylphenyl)methyl]acetamide.
| Compound Name | 2-(3-tert-butyl-5-methyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 23606134 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 2-(3-tert-butyl-5-methyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[(4-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)Cc2c(C)c3cc4c(C(C)(C)C)coc4cc3oc2=O)cc1 |
| InChI | InChI=1S/C26H27NO4/c1-15-6-8-17(9-7-15)13-27-24(28)11-19-16(2)18-10-20-21(26(3,4)5)14-30-22(20)12-23(18)31-25(19)29/h6-10,12,14H,11,13H2,1-5H3,(H,27,28) |
| InChIKey | HEXXXDXNBIBNPP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|