C25H26N2O4 — CID 4870604
2-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 4870604) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4870604 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | Cc1c(CC(=O)NCc2cccnc2)c(=O)oc2c(C)c3occ(C(C)(C)C)c3cc12 |
| InChI | InChI=1S/C25H26N2O4/c1-14-17-9-19-20(25(3,4)5)13-30-22(19)15(2)23(17)31-24(29)18(14)10-21(28)27-12-16-7-6-8-26-11-16/h6-9,11,13H,10,12H2,1-5H3,(H,27,28) |
| InChIKey | DQPBUKFZVBNRAU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|