C28H30FNO4 — CID 23606111
3-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[2-(2-fluorophenyl)ethyl]propanamide (PubChem CID 23606111) has the molecular formula C28H30FNO4 and a molecular weight of 463.55 g/mol. Its IUPAC name is 3-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[2-(2-fluorophenyl)ethyl]propanamide.
| Compound Name | 3-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[2-(2-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 23606111 |
| Molecular Formula | C28H30FNO4 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 3-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)-N-[2-(2-fluorophenyl)ethyl]propanamide |
| SMILES | Cc1c(CCC(=O)NCCc2ccccc2F)c(=O)oc2c(C)c3occ(C(C)(C)C)c3cc12 |
| InChI | InChI=1S/C28H30FNO4/c1-16-19(10-11-24(31)30-13-12-18-8-6-7-9-23(18)29)27(32)34-26-17(2)25-21(14-20(16)26)22(15-33-25)28(3,4)5/h6-9,14-15H,10-13H2,1-5H3,(H,30,31) |
| InChIKey | UVHRHMIZMKJZMB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|