C20H18FNO5 — CID 6237344
2-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-[2-(2-fluorophenyl)ethyl]acetamide (PubChem CID 6237344) has the molecular formula C20H18FNO5 and a molecular weight of 371.36 g/mol. Its IUPAC name is 2-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-[2-(2-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-[2-(2-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 6237344 |
| Molecular Formula | C20H18FNO5 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-[2-(2-fluorophenyl)ethyl]acetamide |
| SMILES | Cc1c(CC(=O)NCCc2ccccc2F)c(=O)oc2c(O)c(O)ccc12 |
| InChI | InChI=1S/C20H18FNO5/c1-11-13-6-7-16(23)18(25)19(13)27-20(26)14(11)10-17(24)22-9-8-12-4-2-3-5-15(12)21/h2-7,23,25H,8-10H2,1H3,(H,22,24) |
| InChIKey | POLQQROHTMTVOA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|