C16H16FNO3 — CID 113199033
2-(3,4-dihydroxyphenyl)-N-[2-(2-fluorophenyl)ethyl]acetamide (PubChem CID 113199033) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-N-[2-(2-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(3,4-dihydroxyphenyl)-N-[2-(2-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 113199033 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-N-[2-(2-fluorophenyl)ethyl]acetamide |
| SMILES | O=C(Cc1ccc(O)c(O)c1)NCCc1ccccc1F |
| InChI | InChI=1S/C16H16FNO3/c17-13-4-2-1-3-12(13)7-8-18-16(21)10-11-5-6-14(19)15(20)9-11/h1-6,9,19-20H,7-8,10H2,(H,18,21) |
| InChIKey | HEVNQHXZEDWMPJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|