C17H19NO4 — CID 113199035
2-(3,4-dihydroxyphenyl)-N-[2-(2-methoxyphenyl)ethyl]acetamide (PubChem CID 113199035) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-N-[2-(2-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(3,4-dihydroxyphenyl)-N-[2-(2-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 113199035 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-N-[2-(2-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccccc1CCNC(=O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H19NO4/c1-22-16-5-3-2-4-13(16)8-9-18-17(21)11-12-6-7-14(19)15(20)10-12/h2-7,10,19-20H,8-9,11H2,1H3,(H,18,21) |
| InChIKey | VVOOSEAGFPLPCK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|