C19H16FNO4 — CID 78799931
N-[2-(3,4-dihydroxyphenyl)ethyl]-5-(2-fluorophenyl)furan-2-carboxamide (PubChem CID 78799931) has the molecular formula C19H16FNO4 and a molecular weight of 341.34 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-5-(2-fluorophenyl)furan-2-carboxamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-5-(2-fluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 78799931 |
| Molecular Formula | C19H16FNO4 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-5-(2-fluorophenyl)furan-2-carboxamide |
| SMILES | O=C(NCCc1ccc(O)c(O)c1)c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C19H16FNO4/c20-14-4-2-1-3-13(14)17-7-8-18(25-17)19(24)21-10-9-12-5-6-15(22)16(23)11-12/h1-8,11,22-23H,9-10H2,(H,21,24) |
| InChIKey | ZSVKGOIEEPOKAV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|