C17H14O4 — CID 5428528
3-benzyl-7,8-dihydroxy-4-methylchromen-2-one (PubChem CID 5428528) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-benzyl-7,8-dihydroxy-4-methylchromen-2-one.
| Compound Name | 3-benzyl-7,8-dihydroxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 5428528 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-benzyl-7,8-dihydroxy-4-methylchromen-2-one |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2c(O)c(O)ccc12 |
| InChI | InChI=1S/C17H14O4/c1-10-12-7-8-14(18)15(19)16(12)21-17(20)13(10)9-11-5-3-2-4-6-11/h2-8,18-19H,9H2,1H3 |
| InChIKey | DLDOVDSFVAFCQE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|