C22H26ClNO4 — CID 44668155
3-benzyl-7-hydroxy-8-[(3-methoxypropylamino)methyl]-4-methylchromen-2-one;hydrochloride (PubChem CID 44668155) has the molecular formula C22H26ClNO4 and a molecular weight of 403.91 g/mol. Its IUPAC name is 3-benzyl-7-hydroxy-8-[(3-methoxypropylamino)methyl]-4-methylchromen-2-one;hydrochloride.
| Compound Name | 3-benzyl-7-hydroxy-8-[(3-methoxypropylamino)methyl]-4-methylchromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 44668155 |
| Molecular Formula | C22H26ClNO4 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 3-benzyl-7-hydroxy-8-[(3-methoxypropylamino)methyl]-4-methylchromen-2-one;hydrochloride |
| SMILES | COCCCNCc1c(O)ccc2c(C)c(Cc3ccccc3)c(=O)oc12.Cl |
| InChI | InChI=1S/C22H25NO4.ClH/c1-15-17-9-10-20(24)19(14-23-11-6-12-26-2)21(17)27-22(25)18(15)13-16-7-4-3-5-8-16;/h3-5,7-10,23-24H,6,11-14H2,1-2H3;1H |
| InChIKey | PYYKGZXJSMVYGG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|