C21H21Cl2NO5 — CID 45370215
methyl 2-[8-[(benzylamino)methyl]-6-chloro-7-hydroxy-4-methyl-2-oxochromen-3-yl]acetate;hydrochloride (PubChem CID 45370215) has the molecular formula C21H21Cl2NO5 and a molecular weight of 438.31 g/mol. Its IUPAC name is methyl 2-[8-[(benzylamino)methyl]-6-chloro-7-hydroxy-4-methyl-2-oxochromen-3-yl]acetate;hydrochloride.
| Compound Name | methyl 2-[8-[(benzylamino)methyl]-6-chloro-7-hydroxy-4-methyl-2-oxochromen-3-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 45370215 |
| Molecular Formula | C21H21Cl2NO5 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | methyl 2-[8-[(benzylamino)methyl]-6-chloro-7-hydroxy-4-methyl-2-oxochromen-3-yl]acetate;hydrochloride |
| SMILES | COC(=O)Cc1c(C)c2cc(Cl)c(O)c(CNCc3ccccc3)c2oc1=O.Cl |
| InChI | InChI=1S/C21H20ClNO5.ClH/c1-12-14-8-17(22)19(25)16(11-23-10-13-6-4-3-5-7-13)20(14)28-21(26)15(12)9-18(24)27-2;/h3-8,23,25H,9-11H2,1-2H3;1H |
| InChIKey | PELKPPJGPCWRRG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|