C20H16ClNO7 — CID 1422245
methyl 2-[6-chloro-4-methyl-7-[(4-nitrophenyl)methoxy]-2-oxochromen-3-yl]acetate (PubChem CID 1422245) has the molecular formula C20H16ClNO7 and a molecular weight of 417.80 g/mol. Its IUPAC name is methyl 2-[6-chloro-4-methyl-7-[(4-nitrophenyl)methoxy]-2-oxochromen-3-yl]acetate.
| Compound Name | methyl 2-[6-chloro-4-methyl-7-[(4-nitrophenyl)methoxy]-2-oxochromen-3-yl]acetate |
|---|---|
| PubChem CID | 1422245 |
| Molecular Formula | C20H16ClNO7 |
| Molecular Weight | 417.80 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | methyl 2-[6-chloro-4-methyl-7-[(4-nitrophenyl)methoxy]-2-oxochromen-3-yl]acetate |
| SMILES | COC(=O)Cc1c(C)c2cc(Cl)c(OCc3ccc([N+](=O)[O-])cc3)cc2oc1=O |
| InChI | InChI=1S/C20H16ClNO7/c1-11-14-7-16(21)18(28-10-12-3-5-13(6-4-12)22(25)26)9-17(14)29-20(24)15(11)8-19(23)27-2/h3-7,9H,8,10H2,1-2H3 |
| InChIKey | DZHRKLNYZCXULG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 108.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.80 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|