C22H19ClO7 — CID 1294723
methyl 2-[6-chloro-7-[2-(4-methoxyphenyl)-2-oxoethoxy]-4-methyl-2-oxochromen-3-yl]acetate (PubChem CID 1294723) has the molecular formula C22H19ClO7 and a molecular weight of 430.84 g/mol. Its IUPAC name is methyl 2-[6-chloro-7-[2-(4-methoxyphenyl)-2-oxoethoxy]-4-methyl-2-oxochromen-3-yl]acetate.
| Compound Name | methyl 2-[6-chloro-7-[2-(4-methoxyphenyl)-2-oxoethoxy]-4-methyl-2-oxochromen-3-yl]acetate |
|---|---|
| PubChem CID | 1294723 |
| Molecular Formula | C22H19ClO7 |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | methyl 2-[6-chloro-7-[2-(4-methoxyphenyl)-2-oxoethoxy]-4-methyl-2-oxochromen-3-yl]acetate |
| SMILES | COC(=O)Cc1c(C)c2cc(Cl)c(OCC(=O)c3ccc(OC)cc3)cc2oc1=O |
| InChI | InChI=1S/C22H19ClO7/c1-12-15-8-17(23)20(10-19(15)30-22(26)16(12)9-21(25)28-3)29-11-18(24)13-4-6-14(27-2)7-5-13/h4-8,10H,9,11H2,1-3H3 |
| InChIKey | ZNJHQLWIZOQIER-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|