C12H8Cl2O5 — CID 23986916
2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid (PubChem CID 23986916) has the molecular formula C12H8Cl2O5 and a molecular weight of 303.10 g/mol. Its IUPAC name is 2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid.
| Compound Name | 2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid |
|---|---|
| PubChem CID | 23986916 |
| Molecular Formula | C12H8Cl2O5 |
| Molecular Weight | 303.10 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid |
| SMILES | Cc1c(Cl)c(=O)oc2cc(OCC(=O)O)c(Cl)cc12 |
| InChI | InChI=1S/C12H8Cl2O5/c1-5-6-2-7(13)9(18-4-10(15)16)3-8(6)19-12(17)11(5)14/h2-3H,4H2,1H3,(H,15,16) |
| InChIKey | YLRPHVBNWDTTMN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.10 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|