2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid

C12H8Cl2O5 — CID 23986916

IUPAC2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid
SMILESCc1c(Cl)c(=O)oc2cc(OCC(=O)O)c(Cl)cc12
InChIInChI=1S/C12H8Cl2O5/c1-5-6-2-7(13)9(18-4-10(15)16)3-8(6)19-12(17)11(5)14/h2-3H,4H2,1H3,(H,15,16)
InChIKeyYLRPHVBNWDTTMN-UHFFFAOYSA-N
MW303.10 g/mol
LogP2.87
Rot. Bonds3

About 2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid

2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid (PubChem CID 23986916) has the molecular formula C12H8Cl2O5 and a molecular weight of 303.10 g/mol. Its IUPAC name is 2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid.

Molecular Properties

Compound Name2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid
PubChem CID23986916
Molecular FormulaC12H8Cl2O5
Molecular Weight303.10 g/mol
Exact Mass301.97
IUPAC Name2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid
SMILESCc1c(Cl)c(=O)oc2cc(OCC(=O)O)c(Cl)cc12
InChIInChI=1S/C12H8Cl2O5/c1-5-6-2-7(13)9(18-4-10(15)16)3-8(6)19-12(17)11(5)14/h2-3H,4H2,1H3,(H,15,16)
InChIKeyYLRPHVBNWDTTMN-UHFFFAOYSA-N
XLogP2.87
TPSA76.74 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.10
LogP ≤ 52.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cumarine', 'substructure': 'N/A'}

Analyze 2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid?
The IUPAC name of 2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid (CID 23986916) is 2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid.
What is the SMILES notation for 2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid?
The canonical SMILES for 2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid is Cc1c(Cl)c(=O)oc2cc(OCC(=O)O)c(Cl)cc12.
What is the InChIKey of 2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid?
The InChIKey is YLRPHVBNWDTTMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2O5/c1-5-6-2-7(13)9(18-4-10(15)16)3-8(6)19-12(17)11(5)14/h2-3H,4H2,1H3,(H,15,16).
What are the key properties of 2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid?
2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid has a molecular weight of 303.10 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxyacetic acid is sourced from PubChem (CID 23986916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).