C19H22ClNO5 — CID 171914731
2-(6-chloro-3,4-dimethyl-2-oxochromen-7-yl)oxy-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide (PubChem CID 171914731) has the molecular formula C19H22ClNO5 and a molecular weight of 379.84 g/mol. Its IUPAC name is 2-(6-chloro-3,4-dimethyl-2-oxochromen-7-yl)oxy-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide.
| Compound Name | 2-(6-chloro-3,4-dimethyl-2-oxochromen-7-yl)oxy-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 171914731 |
| Molecular Formula | C19H22ClNO5 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-(6-chloro-3,4-dimethyl-2-oxochromen-7-yl)oxy-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide |
| SMILES | Cc1c(C)c2cc(Cl)c(OCC(=O)N[C@H]3CCCC[C@@H]3O)cc2oc1=O |
| InChI | InChI=1S/C19H22ClNO5/c1-10-11(2)19(24)26-16-8-17(13(20)7-12(10)16)25-9-18(23)21-14-5-3-4-6-15(14)22/h7-8,14-15,22H,3-6,9H2,1-2H3,(H,21,23)/t14-,15-/m0/s1 |
| InChIKey | BELJWDTVLFOEHN-GJZGRUSLSA-N |
| XLogP | 2.86 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|