C15H20ClNO3 — CID 104956953
2-(2-chloro-5-methylphenoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide (PubChem CID 104956953) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is 2-(2-chloro-5-methylphenoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide.
| Compound Name | 2-(2-chloro-5-methylphenoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 104956953 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-(2-chloro-5-methylphenoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide |
| SMILES | Cc1ccc(Cl)c(OCC(=O)N[C@H]2CCCC[C@@H]2O)c1 |
| InChI | InChI=1S/C15H20ClNO3/c1-10-6-7-11(16)14(8-10)20-9-15(19)17-12-4-2-3-5-13(12)18/h6-8,12-13,18H,2-5,9H2,1H3,(H,17,19)/t12-,13-/m0/s1 |
| InChIKey | QLJXQSXGBNPXBJ-STQMWFEESA-N |
| XLogP | 2.45 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |