C14H16Cl3NO3 — CID 62367000
N-(2-hydroxycyclohexyl)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 62367000) has the molecular formula C14H16Cl3NO3 and a molecular weight of 352.65 g/mol. Its IUPAC name is N-(2-hydroxycyclohexyl)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(2-hydroxycyclohexyl)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 62367000 |
| Molecular Formula | C14H16Cl3NO3 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | N-(2-hydroxycyclohexyl)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NC1CCCCC1O |
| InChI | InChI=1S/C14H16Cl3NO3/c15-8-5-10(17)13(6-9(8)16)21-7-14(20)18-11-3-1-2-4-12(11)19/h5-6,11-12,19H,1-4,7H2,(H,18,20) |
| InChIKey | LXIWSMFHHFOERB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|