C12H10Cl3NO4 — CID 2525176
N-[(3R)-2-oxooxolan-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 2525176) has the molecular formula C12H10Cl3NO4 and a molecular weight of 338.57 g/mol. Its IUPAC name is N-[(3R)-2-oxooxolan-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(3R)-2-oxooxolan-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 2525176 |
| Molecular Formula | C12H10Cl3NO4 |
| Molecular Weight | 338.57 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | N-[(3R)-2-oxooxolan-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)N[C@@H]1CCOC1=O |
| InChI | InChI=1S/C12H10Cl3NO4/c13-6-3-8(15)10(4-7(6)14)20-5-11(17)16-9-1-2-19-12(9)18/h3-4,9H,1-2,5H2,(H,16,17)/t9-/m1/s1 |
| InChIKey | GULIWJFIVCRLMB-SECBINFHSA-N |
| XLogP | 2.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.57 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|