C17H24Cl3N2O2+ — CID 7477102
N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 7477102) has the molecular formula C17H24Cl3N2O2+ and a molecular weight of 394.75 g/mol. Its IUPAC name is N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 7477102 |
| Molecular Formula | C17H24Cl3N2O2+ |
| Molecular Weight | 394.75 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | CC1(C)CC(NC(=O)COc2cc(Cl)c(Cl)cc2Cl)CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C17H23Cl3N2O2/c1-16(2)7-10(8-17(3,4)22-16)21-15(23)9-24-14-6-12(19)11(18)5-13(14)20/h5-6,10,22H,7-9H2,1-4H3,(H,21,23)/p+1 |
| InChIKey | QSTPHRWMTCJLOA-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|