C15H17Cl3F2N2O2 — CID 49074675
N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 49074675) has the molecular formula C15H17Cl3F2N2O2 and a molecular weight of 401.67 g/mol. Its IUPAC name is N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 49074675 |
| Molecular Formula | C15H17Cl3F2N2O2 |
| Molecular Weight | 401.67 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C15H17Cl3F2N2O2/c16-10-5-12(18)13(6-11(10)17)24-8-15(23)21-9-1-3-22(4-2-9)7-14(19)20/h5-6,9,14H,1-4,7-8H2,(H,21,23) |
| InChIKey | BUNXSBFBGRTEFT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|