C20H20Cl3FN2O2 — CID 55847982
N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 55847982) has the molecular formula C20H20Cl3FN2O2 and a molecular weight of 445.75 g/mol. Its IUPAC name is N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 55847982 |
| Molecular Formula | C20H20Cl3FN2O2 |
| Molecular Weight | 445.75 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NC1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H20Cl3FN2O2/c21-16-9-18(23)19(10-17(16)22)28-12-20(27)25-15-5-7-26(8-6-15)11-13-1-3-14(24)4-2-13/h1-4,9-10,15H,5-8,11-12H2,(H,25,27) |
| InChIKey | HLGGUPOZIFUAJW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.75 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|