C12H13Cl3N2O2 — CID 119453282
N-pyrrolidin-3-yl-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 119453282) has the molecular formula C12H13Cl3N2O2 and a molecular weight of 323.61 g/mol. Its IUPAC name is N-pyrrolidin-3-yl-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-pyrrolidin-3-yl-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 119453282 |
| Molecular Formula | C12H13Cl3N2O2 |
| Molecular Weight | 323.61 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | N-pyrrolidin-3-yl-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NC1CCNC1 |
| InChI | InChI=1S/C12H13Cl3N2O2/c13-8-3-10(15)11(4-9(8)14)19-6-12(18)17-7-1-2-16-5-7/h3-4,7,16H,1-2,5-6H2,(H,17,18) |
| InChIKey | WHNUXIDRWTUMGS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.61 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|