C14H17Cl2NO3 — CID 104956681
2-(2,5-dichlorophenoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide (PubChem CID 104956681) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 104956681 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C14H17Cl2NO3/c15-9-5-6-10(16)13(7-9)20-8-14(19)17-11-3-1-2-4-12(11)18/h5-7,11-12,18H,1-4,8H2,(H,17,19)/t11-,12-/m0/s1 |
| InChIKey | LQZCFOZYNQZBIO-RYUDHWBXSA-N |
| XLogP | 2.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |