C14H15Cl3O4 — CID 1019497
[(1R,2S)-2-hydroxycyclohexyl] 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 1019497) has the molecular formula C14H15Cl3O4 and a molecular weight of 353.63 g/mol. Its IUPAC name is [(1R,2S)-2-hydroxycyclohexyl] 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | [(1R,2S)-2-hydroxycyclohexyl] 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 1019497 |
| Molecular Formula | C14H15Cl3O4 |
| Molecular Weight | 353.63 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | [(1R,2S)-2-hydroxycyclohexyl] 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)O[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C14H15Cl3O4/c15-8-5-10(17)13(6-9(8)16)20-7-14(19)21-12-4-2-1-3-11(12)18/h5-6,11-12,18H,1-4,7H2/t11-,12+/m0/s1 |
| InChIKey | MVSZPMNILBYIPQ-NWDGAFQWSA-N |
| XLogP | 3.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|