C10H4Cl6O4 — CID 88731720
[2-(2,4,5-trichlorophenoxy)acetyl] 2,2,2-trichloroacetate (PubChem CID 88731720) has the molecular formula C10H4Cl6O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is [2-(2,4,5-trichlorophenoxy)acetyl] 2,2,2-trichloroacetate.
| Compound Name | [2-(2,4,5-trichlorophenoxy)acetyl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 88731720 |
| Molecular Formula | C10H4Cl6O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 397.82 |
| IUPAC Name | [2-(2,4,5-trichlorophenoxy)acetyl] 2,2,2-trichloroacetate |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)OC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H4Cl6O4/c11-4-1-6(13)7(2-5(4)12)19-3-8(17)20-9(18)10(14,15)16/h1-2H,3H2 |
| InChIKey | VWIJWEVRAZVZCQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|