C14H16Cl3NO4 — CID 8785732
[2-(tert-butylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 8785732) has the molecular formula C14H16Cl3NO4 and a molecular weight of 368.64 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 8785732 |
| Molecular Formula | C14H16Cl3NO4 |
| Molecular Weight | 368.64 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | CC(C)(C)NC(=O)COC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl3NO4/c1-14(2,3)18-12(19)6-22-13(20)7-21-11-5-9(16)8(15)4-10(11)17/h4-5H,6-7H2,1-3H3,(H,18,19) |
| InChIKey | DYHVCFFPLAADAN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|