C15H18Cl3NO4 — CID 7999915
[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 7999915) has the molecular formula C15H18Cl3NO4 and a molecular weight of 382.67 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 7999915 |
| Molecular Formula | C15H18Cl3NO4 |
| Molecular Weight | 382.67 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | CCC[C@@H](C)NC(=O)COC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H18Cl3NO4/c1-3-4-9(2)19-14(20)7-23-15(21)8-22-13-6-11(17)10(16)5-12(13)18/h5-6,9H,3-4,7-8H2,1-2H3,(H,19,20)/t9-/m1/s1 |
| InChIKey | UAZJPCRCGYAXNO-SECBINFHSA-N |
| XLogP | 3.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|