C11H14Cl4N2O2 — CID 120509155
N-[(2S)-1-aminopropan-2-yl]-2-(2,4,5-trichlorophenoxy)acetamide;hydrochloride (PubChem CID 120509155) has the molecular formula C11H14Cl4N2O2 and a molecular weight of 348.06 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-2-(2,4,5-trichlorophenoxy)acetamide;hydrochloride.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-2-(2,4,5-trichlorophenoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120509155 |
| Molecular Formula | C11H14Cl4N2O2 |
| Molecular Weight | 348.06 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-2-(2,4,5-trichlorophenoxy)acetamide;hydrochloride |
| SMILES | C[C@@H](CN)NC(=O)COc1cc(Cl)c(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C11H13Cl3N2O2.ClH/c1-6(4-15)16-11(17)5-18-10-3-8(13)7(12)2-9(10)14;/h2-3,6H,4-5,15H2,1H3,(H,16,17);1H/t6-;/m0./s1 |
| InChIKey | CZRVOJRBVBPZEJ-RGMNGODLSA-N |
| XLogP | 2.91 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.06 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|